C19H40O6P2 — CID 134930337
9,9-bis(diethoxyphosphoryl)-2,6-dimethylnon-2-ene (PubChem CID 134930337) has the molecular formula C19H40O6P2 and a molecular weight of 426.47 g/mol. Its IUPAC name is 9,9-bis(diethoxyphosphoryl)-2,6-dimethylnon-2-ene.
| Compound Name | 9,9-bis(diethoxyphosphoryl)-2,6-dimethylnon-2-ene |
|---|---|
| PubChem CID | 134930337 |
| Molecular Formula | C19H40O6P2 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | 9,9-bis(diethoxyphosphoryl)-2,6-dimethylnon-2-ene |
| SMILES | CCOP(=O)(OCC)C(CCC(C)CCC=C(C)C)P(=O)(OCC)OCC |
| InChI | InChI=1S/C19H40O6P2/c1-8-22-26(20,23-9-2)19(27(21,24-10-3)25-11-4)16-15-18(7)14-12-13-17(5)6/h13,18-19H,8-12,14-16H2,1-7H3 |
| InChIKey | MJKASYAFIGKAAK-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|