C9H18O3S — CID 111435418
1-cyclopentylsulfonyl-2-methylpropan-2-ol (PubChem CID 111435418) has the molecular formula C9H18O3S and a molecular weight of 206.31 g/mol. Its IUPAC name is 1-cyclopentylsulfonyl-2-methylpropan-2-ol.
| Compound Name | 1-cyclopentylsulfonyl-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 111435418 |
| Molecular Formula | C9H18O3S |
| Molecular Weight | 206.31 g/mol |
| Exact Mass | 206.10 |
| IUPAC Name | 1-cyclopentylsulfonyl-2-methylpropan-2-ol |
| SMILES | CC(C)(O)CS(=O)(=O)C1CCCC1 |
| InChI | InChI=1S/C9H18O3S/c1-9(2,10)7-13(11,12)8-5-3-4-6-8/h8,10H,3-7H2,1-2H3 |
| InChIKey | BSZSCKNMYJHPBM-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |