C16H22ClNO4S — CID 1476391
(2S)-N-(4-chlorophenyl)-3-cyclohexylsulfonyl-2-hydroxy-2-methylpropanamide (PubChem CID 1476391) has the molecular formula C16H22ClNO4S and a molecular weight of 359.88 g/mol. Its IUPAC name is (2S)-N-(4-chlorophenyl)-3-cyclohexylsulfonyl-2-hydroxy-2-methylpropanamide.
| Compound Name | (2S)-N-(4-chlorophenyl)-3-cyclohexylsulfonyl-2-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 1476391 |
| Molecular Formula | C16H22ClNO4S |
| Molecular Weight | 359.88 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | (2S)-N-(4-chlorophenyl)-3-cyclohexylsulfonyl-2-hydroxy-2-methylpropanamide |
| SMILES | C[C@@](O)(CS(=O)(=O)C1CCCCC1)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H22ClNO4S/c1-16(20,11-23(21,22)14-5-3-2-4-6-14)15(19)18-13-9-7-12(17)8-10-13/h7-10,14,20H,2-6,11H2,1H3,(H,18,19)/t16-/m1/s1 |
| InChIKey | OAFXXDAKANEVIM-MRXNPFEDSA-N |
| XLogP | 2.78 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.88 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |