C16H15Cl2NO4S — CID 1476404
(2S)-N-(4-chlorophenyl)-3-(3-chlorophenyl)sulfonyl-2-hydroxy-2-methylpropanamide (PubChem CID 1476404) has the molecular formula C16H15Cl2NO4S and a molecular weight of 388.27 g/mol. Its IUPAC name is (2S)-N-(4-chlorophenyl)-3-(3-chlorophenyl)sulfonyl-2-hydroxy-2-methylpropanamide.
| Compound Name | (2S)-N-(4-chlorophenyl)-3-(3-chlorophenyl)sulfonyl-2-hydroxy-2-methylpropanamide |
|---|---|
| PubChem CID | 1476404 |
| Molecular Formula | C16H15Cl2NO4S |
| Molecular Weight | 388.27 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | (2S)-N-(4-chlorophenyl)-3-(3-chlorophenyl)sulfonyl-2-hydroxy-2-methylpropanamide |
| SMILES | C[C@@](O)(CS(=O)(=O)c1cccc(Cl)c1)C(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15Cl2NO4S/c1-16(21,15(20)19-13-7-5-11(17)6-8-13)10-24(22,23)14-4-2-3-12(18)9-14/h2-9,21H,10H2,1H3,(H,19,20)/t16-/m1/s1 |
| InChIKey | INRZVJDFGUNHKL-MRXNPFEDSA-N |
| XLogP | 3.16 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.27 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |