C15H14ClNO4S — CID 1486366
2-(3-chlorophenyl)sulfonyl-N-(4-methoxyphenyl)acetamide (PubChem CID 1486366) has the molecular formula C15H14ClNO4S and a molecular weight of 339.80 g/mol. Its IUPAC name is 2-(3-chlorophenyl)sulfonyl-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-(3-chlorophenyl)sulfonyl-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 1486366 |
| Molecular Formula | C15H14ClNO4S |
| Molecular Weight | 339.80 g/mol |
| Exact Mass | 339.03 |
| IUPAC Name | 2-(3-chlorophenyl)sulfonyl-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)CS(=O)(=O)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C15H14ClNO4S/c1-21-13-7-5-12(6-8-13)17-15(18)10-22(19,20)14-4-2-3-11(16)9-14/h2-9H,10H2,1H3,(H,17,18) |
| InChIKey | NXCYBQJILDPVGC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.80 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |