C19H20N2O3 — CID 111435548
N-[(1-hydroxycyclobutyl)methyl]-N'-(2-phenylphenyl)oxamide (PubChem CID 111435548) has the molecular formula C19H20N2O3 and a molecular weight of 324.38 g/mol. Its IUPAC name is N-[(1-hydroxycyclobutyl)methyl]-N'-(2-phenylphenyl)oxamide.
| Compound Name | N-[(1-hydroxycyclobutyl)methyl]-N'-(2-phenylphenyl)oxamide |
|---|---|
| PubChem CID | 111435548 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | N-[(1-hydroxycyclobutyl)methyl]-N'-(2-phenylphenyl)oxamide |
| SMILES | O=C(NCC1(O)CCC1)C(=O)Nc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C19H20N2O3/c22-17(20-13-19(24)11-6-12-19)18(23)21-16-10-5-4-9-15(16)14-7-2-1-3-8-14/h1-5,7-10,24H,6,11-13H2,(H,20,22)(H,21,23) |
| InChIKey | UDMDCWHATBUXCX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|