C16H20FNO3 — CID 111439826
4-[3-fluoro-N-(furan-2-ylmethyl)-4-methoxyanilino]butan-1-ol (PubChem CID 111439826) has the molecular formula C16H20FNO3 and a molecular weight of 293.34 g/mol. Its IUPAC name is 4-[3-fluoro-N-(furan-2-ylmethyl)-4-methoxyanilino]butan-1-ol.
| Compound Name | 4-[3-fluoro-N-(furan-2-ylmethyl)-4-methoxyanilino]butan-1-ol |
|---|---|
| PubChem CID | 111439826 |
| Molecular Formula | C16H20FNO3 |
| Molecular Weight | 293.34 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 4-[3-fluoro-N-(furan-2-ylmethyl)-4-methoxyanilino]butan-1-ol |
| SMILES | COc1ccc(N(CCCCO)Cc2ccco2)cc1F |
| InChI | InChI=1S/C16H20FNO3/c1-20-16-7-6-13(11-15(16)17)18(8-2-3-9-19)12-14-5-4-10-21-14/h4-7,10-11,19H,2-3,8-9,12H2,1H3 |
| InChIKey | RUUDTEZKNCONLI-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 45.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|