C17H17FN2O3 — CID 86910321
N-(2-cyanoethyl)-2-(3-fluoro-4-methoxyphenyl)-N-(furan-2-ylmethyl)acetamide (PubChem CID 86910321) has the molecular formula C17H17FN2O3 and a molecular weight of 316.33 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-(3-fluoro-4-methoxyphenyl)-N-(furan-2-ylmethyl)acetamide.
| Compound Name | N-(2-cyanoethyl)-2-(3-fluoro-4-methoxyphenyl)-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 86910321 |
| Molecular Formula | C17H17FN2O3 |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | N-(2-cyanoethyl)-2-(3-fluoro-4-methoxyphenyl)-N-(furan-2-ylmethyl)acetamide |
| SMILES | COc1ccc(CC(=O)N(CCC#N)Cc2ccco2)cc1F |
| InChI | InChI=1S/C17H17FN2O3/c1-22-16-6-5-13(10-15(16)18)11-17(21)20(8-3-7-19)12-14-4-2-9-23-14/h2,4-6,9-10H,3,8,11-12H2,1H3 |
| InChIKey | HHMYJQCEPHIXFQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 66.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |