C18H17FN2O4 — CID 18092409
[2-[2-cyanoethyl(furan-2-ylmethyl)amino]-2-oxoethyl] 3-fluoro-4-methylbenzoate (PubChem CID 18092409) has the molecular formula C18H17FN2O4 and a molecular weight of 344.34 g/mol. Its IUPAC name is [2-[2-cyanoethyl(furan-2-ylmethyl)amino]-2-oxoethyl] 3-fluoro-4-methylbenzoate.
| Compound Name | [2-[2-cyanoethyl(furan-2-ylmethyl)amino]-2-oxoethyl] 3-fluoro-4-methylbenzoate |
|---|---|
| PubChem CID | 18092409 |
| Molecular Formula | C18H17FN2O4 |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | [2-[2-cyanoethyl(furan-2-ylmethyl)amino]-2-oxoethyl] 3-fluoro-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)N(CCC#N)Cc2ccco2)cc1F |
| InChI | InChI=1S/C18H17FN2O4/c1-13-5-6-14(10-16(13)19)18(23)25-12-17(22)21(8-3-7-20)11-15-4-2-9-24-15/h2,4-6,9-10H,3,8,11-12H2,1H3 |
| InChIKey | XUBQFVFKPCLPOI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 83.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |