C17H16N2O4 — CID 38898878
N-(2-cyanoethyl)-2-(2-formylphenoxy)-N-(furan-2-ylmethyl)acetamide (PubChem CID 38898878) has the molecular formula C17H16N2O4 and a molecular weight of 312.33 g/mol. Its IUPAC name is N-(2-cyanoethyl)-2-(2-formylphenoxy)-N-(furan-2-ylmethyl)acetamide.
| Compound Name | N-(2-cyanoethyl)-2-(2-formylphenoxy)-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 38898878 |
| Molecular Formula | C17H16N2O4 |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | N-(2-cyanoethyl)-2-(2-formylphenoxy)-N-(furan-2-ylmethyl)acetamide |
| SMILES | N#CCCN(Cc1ccco1)C(=O)COc1ccccc1C=O |
| InChI | InChI=1S/C17H16N2O4/c18-8-4-9-19(11-15-6-3-10-22-15)17(21)13-23-16-7-2-1-5-14(16)12-20/h1-3,5-7,10,12H,4,9,11,13H2 |
| InChIKey | ODRWONPGWBCIKT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 83.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|