C17H22N2O2 — CID 60519887
2-(2-bicyclo[2.2.1]heptanyl)-N-(2-cyanoethyl)-N-(furan-2-ylmethyl)acetamide (PubChem CID 60519887) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is 2-(2-bicyclo[2.2.1]heptanyl)-N-(2-cyanoethyl)-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-(2-bicyclo[2.2.1]heptanyl)-N-(2-cyanoethyl)-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 60519887 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 2-(2-bicyclo[2.2.1]heptanyl)-N-(2-cyanoethyl)-N-(furan-2-ylmethyl)acetamide |
| SMILES | N#CCCN(Cc1ccco1)C(=O)CC1CC2CCC1C2 |
| InChI | InChI=1S/C17H22N2O2/c18-6-2-7-19(12-16-3-1-8-21-16)17(20)11-15-10-13-4-5-14(15)9-13/h1,3,8,13-15H,2,4-5,7,9-12H2 |
| InChIKey | UQXPEPPLESBPLH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 57.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |