C15H20N4O3 — CID 94409683
(3S)-1-[2-[2-cyanoethyl(furan-2-ylmethyl)amino]-2-oxoethyl]pyrrolidine-3-carboxamide (PubChem CID 94409683) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is (3S)-1-[2-[2-cyanoethyl(furan-2-ylmethyl)amino]-2-oxoethyl]pyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-[2-[2-cyanoethyl(furan-2-ylmethyl)amino]-2-oxoethyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 94409683 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | (3S)-1-[2-[2-cyanoethyl(furan-2-ylmethyl)amino]-2-oxoethyl]pyrrolidine-3-carboxamide |
| SMILES | N#CCCN(Cc1ccco1)C(=O)CN1CC[C@H](C(N)=O)C1 |
| InChI | InChI=1S/C15H20N4O3/c16-5-2-6-19(10-13-3-1-8-22-13)14(20)11-18-7-4-12(9-18)15(17)21/h1,3,8,12H,2,4,6-7,9-11H2,(H2,17,21)/t12-/m0/s1 |
| InChIKey | IFJADSFMWVLOQM-LBPRGKRZSA-N |
| XLogP | 0.33 |
| TPSA | 103.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |