C18H23NO2S — CID 111441195
2-benzyl-N-(2-hydroxy-2-thiophen-3-ylethyl)-3-methylbutanamide (PubChem CID 111441195) has the molecular formula C18H23NO2S and a molecular weight of 317.45 g/mol. Its IUPAC name is 2-benzyl-N-(2-hydroxy-2-thiophen-3-ylethyl)-3-methylbutanamide.
| Compound Name | 2-benzyl-N-(2-hydroxy-2-thiophen-3-ylethyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 111441195 |
| Molecular Formula | C18H23NO2S |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 2-benzyl-N-(2-hydroxy-2-thiophen-3-ylethyl)-3-methylbutanamide |
| SMILES | CC(C)C(Cc1ccccc1)C(=O)NCC(O)c1ccsc1 |
| InChI | InChI=1S/C18H23NO2S/c1-13(2)16(10-14-6-4-3-5-7-14)18(21)19-11-17(20)15-8-9-22-12-15/h3-9,12-13,16-17,20H,10-11H2,1-2H3,(H,19,21) |
| InChIKey | LWVALVQQKOCGGC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |