C14H19Cl2NO2S — CID 111442460
[1-[2-(2,5-dichlorophenyl)sulfinylethyl]piperidin-3-yl]methanol (PubChem CID 111442460) has the molecular formula C14H19Cl2NO2S and a molecular weight of 336.28 g/mol. Its IUPAC name is [1-[2-(2,5-dichlorophenyl)sulfinylethyl]piperidin-3-yl]methanol.
| Compound Name | [1-[2-(2,5-dichlorophenyl)sulfinylethyl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 111442460 |
| Molecular Formula | C14H19Cl2NO2S |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | [1-[2-(2,5-dichlorophenyl)sulfinylethyl]piperidin-3-yl]methanol |
| SMILES | O=S(CCN1CCCC(CO)C1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H19Cl2NO2S/c15-12-3-4-13(16)14(8-12)20(19)7-6-17-5-1-2-11(9-17)10-18/h3-4,8,11,18H,1-2,5-7,9-10H2 |
| InChIKey | WKBRLIGAEUOWOH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |