C14H23N3O4S — CID 111444517
1-(furan-2-ylmethyl)-2-methyl-3-[(4-methylsulfonyloxan-4-yl)methyl]guanidine (PubChem CID 111444517) has the molecular formula C14H23N3O4S and a molecular weight of 329.42 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-2-methyl-3-[(4-methylsulfonyloxan-4-yl)methyl]guanidine.
| Compound Name | 1-(furan-2-ylmethyl)-2-methyl-3-[(4-methylsulfonyloxan-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111444517 |
| Molecular Formula | C14H23N3O4S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 1-(furan-2-ylmethyl)-2-methyl-3-[(4-methylsulfonyloxan-4-yl)methyl]guanidine |
| SMILES | C/N=C(\NCc1ccco1)NCC1(S(C)(=O)=O)CCOCC1 |
| InChI | InChI=1S/C14H23N3O4S/c1-15-13(16-10-12-4-3-7-21-12)17-11-14(22(2,18)19)5-8-20-9-6-14/h3-4,7H,5-6,8-11H2,1-2H3,(H2,15,16,17) |
| InChIKey | VSYKXNSHGNYVCJ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|