C10H19IN4O3S — CID 110934708
1-(furan-2-ylmethyl)-3-[2-(methanesulfonamido)ethyl]-2-methylguanidine;hydroiodide (PubChem CID 110934708) has the molecular formula C10H19IN4O3S and a molecular weight of 402.26 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-[2-(methanesulfonamido)ethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(furan-2-ylmethyl)-3-[2-(methanesulfonamido)ethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110934708 |
| Molecular Formula | C10H19IN4O3S |
| Molecular Weight | 402.26 g/mol |
| Exact Mass | 402.02 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-[2-(methanesulfonamido)ethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCCNS(C)(=O)=O)NCc1ccco1.I |
| InChI | InChI=1S/C10H18N4O3S.HI/c1-11-10(12-5-6-14-18(2,15)16)13-8-9-4-3-7-17-9;/h3-4,7,14H,5-6,8H2,1-2H3,(H2,11,12,13);1H |
| InChIKey | SWMKCKIMTKBBLT-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 95.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.26 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|