C14H14F4IN3O — CID 86778612
1-(furan-2-ylmethyl)-2-methyl-3-[(2,3,5,6-tetrafluorophenyl)methyl]guanidine;hydroiodide (PubChem CID 86778612) has the molecular formula C14H14F4IN3O and a molecular weight of 443.18 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-2-methyl-3-[(2,3,5,6-tetrafluorophenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(furan-2-ylmethyl)-2-methyl-3-[(2,3,5,6-tetrafluorophenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 86778612 |
| Molecular Formula | C14H14F4IN3O |
| Molecular Weight | 443.18 g/mol |
| Exact Mass | 443.01 |
| IUPAC Name | 1-(furan-2-ylmethyl)-2-methyl-3-[(2,3,5,6-tetrafluorophenyl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccco1)NCc1c(F)c(F)cc(F)c1F.I |
| InChI | InChI=1S/C14H13F4N3O.HI/c1-19-14(20-6-8-3-2-4-22-8)21-7-9-12(17)10(15)5-11(16)13(9)18;/h2-5H,6-7H2,1H3,(H2,19,20,21);1H |
| InChIKey | QLULYZDTDNAATQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.18 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|