C16H17NO2 — CID 111445480
N-[(1-hydroxycyclobutyl)methyl]naphthalene-2-carboxamide (PubChem CID 111445480) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is N-[(1-hydroxycyclobutyl)methyl]naphthalene-2-carboxamide.
| Compound Name | N-[(1-hydroxycyclobutyl)methyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 111445480 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | N-[(1-hydroxycyclobutyl)methyl]naphthalene-2-carboxamide |
| SMILES | O=C(NCC1(O)CCC1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C16H17NO2/c18-15(17-11-16(19)8-3-9-16)14-7-6-12-4-1-2-5-13(12)10-14/h1-2,4-7,10,19H,3,8-9,11H2,(H,17,18) |
| InChIKey | BJQKBECYKWSWAL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |