C17H18BrNO — CID 114758301
N-[[1-(2-bromoethyl)cyclopropyl]methyl]naphthalene-2-carboxamide (PubChem CID 114758301) has the molecular formula C17H18BrNO and a molecular weight of 332.24 g/mol. Its IUPAC name is N-[[1-(2-bromoethyl)cyclopropyl]methyl]naphthalene-2-carboxamide.
| Compound Name | N-[[1-(2-bromoethyl)cyclopropyl]methyl]naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 114758301 |
| Molecular Formula | C17H18BrNO |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | N-[[1-(2-bromoethyl)cyclopropyl]methyl]naphthalene-2-carboxamide |
| SMILES | O=C(NCC1(CCBr)CC1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H18BrNO/c18-10-9-17(7-8-17)12-19-16(20)15-6-5-13-3-1-2-4-14(13)11-15/h1-6,11H,7-10,12H2,(H,19,20) |
| InChIKey | CGESIGFTXBINCE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|