C14H18BrNO3 — CID 114758224
N-[[1-(2-bromoethyl)cyclopropyl]methyl]-3-hydroxy-4-methoxybenzamide (PubChem CID 114758224) has the molecular formula C14H18BrNO3 and a molecular weight of 328.21 g/mol. Its IUPAC name is N-[[1-(2-bromoethyl)cyclopropyl]methyl]-3-hydroxy-4-methoxybenzamide.
| Compound Name | N-[[1-(2-bromoethyl)cyclopropyl]methyl]-3-hydroxy-4-methoxybenzamide |
|---|---|
| PubChem CID | 114758224 |
| Molecular Formula | C14H18BrNO3 |
| Molecular Weight | 328.21 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | N-[[1-(2-bromoethyl)cyclopropyl]methyl]-3-hydroxy-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NCC2(CCBr)CC2)cc1O |
| InChI | InChI=1S/C14H18BrNO3/c1-19-12-3-2-10(8-11(12)17)13(18)16-9-14(4-5-14)6-7-15/h2-3,8,17H,4-7,9H2,1H3,(H,16,18) |
| InChIKey | ALYSLGUCQGMIEJ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.21 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|