C12H14BrNOS2 — CID 111449551
1-[(5-bromothiophen-3-yl)methylamino]-2-thiophen-3-ylpropan-2-ol (PubChem CID 111449551) has the molecular formula C12H14BrNOS2 and a molecular weight of 332.29 g/mol. Its IUPAC name is 1-[(5-bromothiophen-3-yl)methylamino]-2-thiophen-3-ylpropan-2-ol.
| Compound Name | 1-[(5-bromothiophen-3-yl)methylamino]-2-thiophen-3-ylpropan-2-ol |
|---|---|
| PubChem CID | 111449551 |
| Molecular Formula | C12H14BrNOS2 |
| Molecular Weight | 332.29 g/mol |
| Exact Mass | 330.97 |
| IUPAC Name | 1-[(5-bromothiophen-3-yl)methylamino]-2-thiophen-3-ylpropan-2-ol |
| SMILES | CC(O)(CNCc1csc(Br)c1)c1ccsc1 |
| InChI | InChI=1S/C12H14BrNOS2/c1-12(15,10-2-3-16-7-10)8-14-5-9-4-11(13)17-6-9/h2-4,6-7,14-15H,5,8H2,1H3 |
| InChIKey | OSABUNXHNHQNQS-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.29 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |