C16H19F2NO3S — CID 111449517
1-[[2-(difluoromethoxy)-5-methoxyphenyl]methylamino]-2-thiophen-3-ylpropan-2-ol (PubChem CID 111449517) has the molecular formula C16H19F2NO3S and a molecular weight of 343.40 g/mol. Its IUPAC name is 1-[[2-(difluoromethoxy)-5-methoxyphenyl]methylamino]-2-thiophen-3-ylpropan-2-ol.
| Compound Name | 1-[[2-(difluoromethoxy)-5-methoxyphenyl]methylamino]-2-thiophen-3-ylpropan-2-ol |
|---|---|
| PubChem CID | 111449517 |
| Molecular Formula | C16H19F2NO3S |
| Molecular Weight | 343.40 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | 1-[[2-(difluoromethoxy)-5-methoxyphenyl]methylamino]-2-thiophen-3-ylpropan-2-ol |
| SMILES | COc1ccc(OC(F)F)c(CNCC(C)(O)c2ccsc2)c1 |
| InChI | InChI=1S/C16H19F2NO3S/c1-16(20,12-5-6-23-9-12)10-19-8-11-7-13(21-2)3-4-14(11)22-15(17)18/h3-7,9,15,19-20H,8,10H2,1-2H3 |
| InChIKey | OXSYBABHPNVCOK-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |