C32H32Si2 — CID 11145157
1,1,2,2-tetramethyl-3,4,5,6-tetraphenyldisiline (PubChem CID 11145157) has the molecular formula C32H32Si2 and a molecular weight of 472.78 g/mol. Its IUPAC name is 1,1,2,2-tetramethyl-3,4,5,6-tetraphenyldisiline.
| Compound Name | 1,1,2,2-tetramethyl-3,4,5,6-tetraphenyldisiline |
|---|---|
| PubChem CID | 11145157 |
| Molecular Formula | C32H32Si2 |
| Molecular Weight | 472.78 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | 1,1,2,2-tetramethyl-3,4,5,6-tetraphenyldisiline |
| SMILES | C[Si]1(C)C(c2ccccc2)=C(c2ccccc2)C(c2ccccc2)=C(c2ccccc2)[Si]1(C)C |
| InChI | InChI=1S/C32H32Si2/c1-33(2)31(27-21-13-7-14-22-27)29(25-17-9-5-10-18-25)30(26-19-11-6-12-20-26)32(34(33,3)4)28-23-15-8-16-24-28/h5-24H,1-4H3 |
| InChIKey | LBSMDDBMJFYWNW-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.78 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|