C13H19ClN2O2 — CID 111452596
1-(4-chloro-2-methylphenyl)-3-(4-hydroxy-3-methylbutan-2-yl)urea (PubChem CID 111452596) has the molecular formula C13H19ClN2O2 and a molecular weight of 270.76 g/mol. Its IUPAC name is 1-(4-chloro-2-methylphenyl)-3-(4-hydroxy-3-methylbutan-2-yl)urea.
| Compound Name | 1-(4-chloro-2-methylphenyl)-3-(4-hydroxy-3-methylbutan-2-yl)urea |
|---|---|
| PubChem CID | 111452596 |
| Molecular Formula | C13H19ClN2O2 |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 1-(4-chloro-2-methylphenyl)-3-(4-hydroxy-3-methylbutan-2-yl)urea |
| SMILES | Cc1cc(Cl)ccc1NC(=O)NC(C)C(C)CO |
| InChI | InChI=1S/C13H19ClN2O2/c1-8-6-11(14)4-5-12(8)16-13(18)15-10(3)9(2)7-17/h4-6,9-10,17H,7H2,1-3H3,(H2,15,16,18) |
| InChIKey | AEXVWMARPSYWMT-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |