C14H18N4O2 — CID 111453132
3-(1-benzylpyrazol-3-yl)-1-(2-hydroxyethyl)-1-methylurea (PubChem CID 111453132) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is 3-(1-benzylpyrazol-3-yl)-1-(2-hydroxyethyl)-1-methylurea.
| Compound Name | 3-(1-benzylpyrazol-3-yl)-1-(2-hydroxyethyl)-1-methylurea |
|---|---|
| PubChem CID | 111453132 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 3-(1-benzylpyrazol-3-yl)-1-(2-hydroxyethyl)-1-methylurea |
| SMILES | CN(CCO)C(=O)Nc1ccn(Cc2ccccc2)n1 |
| InChI | InChI=1S/C14H18N4O2/c1-17(9-10-19)14(20)15-13-7-8-18(16-13)11-12-5-3-2-4-6-12/h2-8,19H,9-11H2,1H3,(H,15,16,20) |
| InChIKey | VGHSNLYTXMJEDX-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |