C27H30N6O2 — CID 112837683
N,N'-bis(1-benzylpyrazol-3-yl)-3-methylhexanediamide (PubChem CID 112837683) has the molecular formula C27H30N6O2 and a molecular weight of 470.58 g/mol. Its IUPAC name is N,N'-bis(1-benzylpyrazol-3-yl)-3-methylhexanediamide.
| Compound Name | N,N'-bis(1-benzylpyrazol-3-yl)-3-methylhexanediamide |
|---|---|
| PubChem CID | 112837683 |
| Molecular Formula | C27H30N6O2 |
| Molecular Weight | 470.58 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | N,N'-bis(1-benzylpyrazol-3-yl)-3-methylhexanediamide |
| SMILES | CC(CCC(=O)Nc1ccn(Cc2ccccc2)n1)CC(=O)Nc1ccn(Cc2ccccc2)n1 |
| InChI | InChI=1S/C27H30N6O2/c1-21(18-27(35)29-25-15-17-33(31-25)20-23-10-6-3-7-11-23)12-13-26(34)28-24-14-16-32(30-24)19-22-8-4-2-5-9-22/h2-11,14-17,21H,12-13,18-20H2,1H3,(H,28,30,34)(H,29,31,35) |
| InChIKey | CFVGNZIHLMUYCR-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.58 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |