C29H42O3Si2 — CID 11145458
(3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-8-[dimethyl(phenyl)silyl]-4-phenylmethoxyocta-6,7-dienal (PubChem CID 11145458) has the molecular formula C29H42O3Si2 and a molecular weight of 494.82 g/mol. Its IUPAC name is (3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-8-[dimethyl(phenyl)silyl]-4-phenylmethoxyocta-6,7-dienal.
| Compound Name | (3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-8-[dimethyl(phenyl)silyl]-4-phenylmethoxyocta-6,7-dienal |
|---|---|
| PubChem CID | 11145458 |
| Molecular Formula | C29H42O3Si2 |
| Molecular Weight | 494.82 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | (3S,4R)-3-[tert-butyl(dimethyl)silyl]oxy-8-[dimethyl(phenyl)silyl]-4-phenylmethoxyocta-6,7-dienal |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H](CC=O)[C@@H](CC=C=C[Si](C)(C)c1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C29H42O3Si2/c1-29(2,3)34(6,7)32-28(21-22-30)27(31-24-25-16-10-8-11-17-25)20-14-15-23-33(4,5)26-18-12-9-13-19-26/h8-14,16-19,22-23,27-28H,20-21,24H2,1-7H3/t15?,27-,28+/m1/s1 |
| InChIKey | MCFJYUQFGQSOIN-UZPFKDSZSA-N |
| XLogP | 6.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.82 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|