About 7-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-3-ethoxy-7-azaspiro[3.5]nonan-1-ol
7-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-3-ethoxy-7-azaspiro[3.5]nonan-1-ol (PubChem CID 111457112) has the molecular formula C17H29N3O3
and a molecular weight of 323.44 g/mol. Its IUPAC name is 7-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-3-ethoxy-7-azaspiro[3.5]nonan-1-ol.
Molecular Properties
| Compound Name | 7-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-3-ethoxy-7-azaspiro[3.5]nonan-1-ol |
| PubChem CID | 111457112 |
| Molecular Formula | C17H29N3O3 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | 7-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-3-ethoxy-7-azaspiro[3.5]nonan-1-ol |
| SMILES | CCCCc1nc(CN2CCC3(CC2)C(O)CC3OCC)no1 |
| InChI | InChI=1S/C17H29N3O3/c1-3-5-6-16-18-15(19-23-16)12-20-9-7-17(8-10-20)13(21)11-14(17)22-4-2/h13-14,21H,3-12H2,1-2H3 |
| InChIKey | ONTXZZOLCYCUNZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 71.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-3-ethoxy-7-azaspiro[3.5]nonan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-3-ethoxy-7-azaspiro[3.5]nonan-1-ol?
The IUPAC name of 7-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-3-ethoxy-7-azaspiro[3.5]nonan-1-ol (CID 111457112) is 7-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-3-ethoxy-7-azaspiro[3.5]nonan-1-ol.
What is the SMILES notation for 7-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-3-ethoxy-7-azaspiro[3.5]nonan-1-ol?
The canonical SMILES for 7-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-3-ethoxy-7-azaspiro[3.5]nonan-1-ol is CCCCc1nc(CN2CCC3(CC2)C(O)CC3OCC)no1.
What is the InChIKey of 7-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-3-ethoxy-7-azaspiro[3.5]nonan-1-ol?
The InChIKey is ONTXZZOLCYCUNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29N3O3/c1-3-5-6-16-18-15(19-23-16)12-20-9-7-17(8-10-20)13(21)11-14(17)22-4-2/h13-14,21H,3-12H2,1-2H3.
What are the key properties of 7-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-3-ethoxy-7-azaspiro[3.5]nonan-1-ol?
7-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-3-ethoxy-7-azaspiro[3.5]nonan-1-ol has a molecular weight of 323.44 g/mol, XLogP of 2.16, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(5-butyl-1,2,4-oxadiazol-3-yl)methyl]-3-ethoxy-7-azaspiro[3.5]nonan-1-ol is sourced from PubChem (CID 111457112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).