C18H26FNO3 — CID 111457198
3-ethoxy-7-[2-(3-fluorophenyl)-2-hydroxyethyl]-7-azaspiro[3.5]nonan-1-ol (PubChem CID 111457198) has the molecular formula C18H26FNO3 and a molecular weight of 323.41 g/mol. Its IUPAC name is 3-ethoxy-7-[2-(3-fluorophenyl)-2-hydroxyethyl]-7-azaspiro[3.5]nonan-1-ol.
| Compound Name | 3-ethoxy-7-[2-(3-fluorophenyl)-2-hydroxyethyl]-7-azaspiro[3.5]nonan-1-ol |
|---|---|
| PubChem CID | 111457198 |
| Molecular Formula | C18H26FNO3 |
| Molecular Weight | 323.41 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | 3-ethoxy-7-[2-(3-fluorophenyl)-2-hydroxyethyl]-7-azaspiro[3.5]nonan-1-ol |
| SMILES | CCOC1CC(O)C12CCN(CC(O)c1cccc(F)c1)CC2 |
| InChI | InChI=1S/C18H26FNO3/c1-2-23-17-11-16(22)18(17)6-8-20(9-7-18)12-15(21)13-4-3-5-14(19)10-13/h3-5,10,15-17,21-22H,2,6-9,11-12H2,1H3 |
| InChIKey | QUWRHODDJWZZBS-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |