C19H24F3NO3 — CID 78087863
1-(3-ethoxy-1-hydroxy-7-azaspiro[3.5]nonan-7-yl)-2-[3-(trifluoromethyl)phenyl]ethanone (PubChem CID 78087863) has the molecular formula C19H24F3NO3 and a molecular weight of 371.40 g/mol. Its IUPAC name is 1-(3-ethoxy-1-hydroxy-7-azaspiro[3.5]nonan-7-yl)-2-[3-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 1-(3-ethoxy-1-hydroxy-7-azaspiro[3.5]nonan-7-yl)-2-[3-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 78087863 |
| Molecular Formula | C19H24F3NO3 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 1-(3-ethoxy-1-hydroxy-7-azaspiro[3.5]nonan-7-yl)-2-[3-(trifluoromethyl)phenyl]ethanone |
| SMILES | CCOC1CC(O)C12CCN(C(=O)Cc1cccc(C(F)(F)F)c1)CC2 |
| InChI | InChI=1S/C19H24F3NO3/c1-2-26-16-12-15(24)18(16)6-8-23(9-7-18)17(25)11-13-4-3-5-14(10-13)19(20,21)22/h3-5,10,15-16,24H,2,6-9,11-12H2,1H3 |
| InChIKey | ZJBNAJCDZJFONZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |