C15H23NO2S — CID 111457428
3-cyclopropyl-3-[(4-methoxy-3-methylsulfanylphenyl)methylamino]propan-1-ol (PubChem CID 111457428) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is 3-cyclopropyl-3-[(4-methoxy-3-methylsulfanylphenyl)methylamino]propan-1-ol.
| Compound Name | 3-cyclopropyl-3-[(4-methoxy-3-methylsulfanylphenyl)methylamino]propan-1-ol |
|---|---|
| PubChem CID | 111457428 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 3-cyclopropyl-3-[(4-methoxy-3-methylsulfanylphenyl)methylamino]propan-1-ol |
| SMILES | COc1ccc(CNC(CCO)C2CC2)cc1SC |
| InChI | InChI=1S/C15H23NO2S/c1-18-14-6-3-11(9-15(14)19-2)10-16-13(7-8-17)12-4-5-12/h3,6,9,12-13,16-17H,4-5,7-8,10H2,1-2H3 |
| InChIKey | JNGAQLNBRCNJAG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |