C17H20ClN3O2 — CID 111457728
1-[(6-chloro-2H-chromen-3-yl)methylamino]-2-(1-methylpyrazol-4-yl)propan-2-ol (PubChem CID 111457728) has the molecular formula C17H20ClN3O2 and a molecular weight of 333.82 g/mol. Its IUPAC name is 1-[(6-chloro-2H-chromen-3-yl)methylamino]-2-(1-methylpyrazol-4-yl)propan-2-ol.
| Compound Name | 1-[(6-chloro-2H-chromen-3-yl)methylamino]-2-(1-methylpyrazol-4-yl)propan-2-ol |
|---|---|
| PubChem CID | 111457728 |
| Molecular Formula | C17H20ClN3O2 |
| Molecular Weight | 333.82 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 1-[(6-chloro-2H-chromen-3-yl)methylamino]-2-(1-methylpyrazol-4-yl)propan-2-ol |
| SMILES | Cn1cc(C(C)(O)CNCC2=Cc3cc(Cl)ccc3OC2)cn1 |
| InChI | InChI=1S/C17H20ClN3O2/c1-17(22,14-8-20-21(2)9-14)11-19-7-12-5-13-6-15(18)3-4-16(13)23-10-12/h3-6,8-9,19,22H,7,10-11H2,1-2H3 |
| InChIKey | UJEUJRGNSWJFCG-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.82 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |