C16H16F2N2O3 — CID 111457941
1-(2,4-difluorophenyl)-3-[[2-(2-hydroxyethoxy)phenyl]methyl]urea (PubChem CID 111457941) has the molecular formula C16H16F2N2O3 and a molecular weight of 322.31 g/mol. Its IUPAC name is 1-(2,4-difluorophenyl)-3-[[2-(2-hydroxyethoxy)phenyl]methyl]urea.
| Compound Name | 1-(2,4-difluorophenyl)-3-[[2-(2-hydroxyethoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 111457941 |
| Molecular Formula | C16H16F2N2O3 |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | 1-(2,4-difluorophenyl)-3-[[2-(2-hydroxyethoxy)phenyl]methyl]urea |
| SMILES | O=C(NCc1ccccc1OCCO)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C16H16F2N2O3/c17-12-5-6-14(13(18)9-12)20-16(22)19-10-11-3-1-2-4-15(11)23-8-7-21/h1-6,9,21H,7-8,10H2,(H2,19,20,22) |
| InChIKey | ACZBXLPUFGXVAD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |