C17H23ClN2O3 — CID 111459554
2-chloro-N-[(1-hydroxycyclopentyl)methyl]-5-(2-methylpropanoylamino)benzamide (PubChem CID 111459554) has the molecular formula C17H23ClN2O3 and a molecular weight of 338.84 g/mol. Its IUPAC name is 2-chloro-N-[(1-hydroxycyclopentyl)methyl]-5-(2-methylpropanoylamino)benzamide.
| Compound Name | 2-chloro-N-[(1-hydroxycyclopentyl)methyl]-5-(2-methylpropanoylamino)benzamide |
|---|---|
| PubChem CID | 111459554 |
| Molecular Formula | C17H23ClN2O3 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 2-chloro-N-[(1-hydroxycyclopentyl)methyl]-5-(2-methylpropanoylamino)benzamide |
| SMILES | CC(C)C(=O)Nc1ccc(Cl)c(C(=O)NCC2(O)CCCC2)c1 |
| InChI | InChI=1S/C17H23ClN2O3/c1-11(2)15(21)20-12-5-6-14(18)13(9-12)16(22)19-10-17(23)7-3-4-8-17/h5-6,9,11,23H,3-4,7-8,10H2,1-2H3,(H,19,22)(H,20,21) |
| InChIKey | JRBRYOBZYVZNTI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |