C17H32N2O3 — CID 111460537
N-[4-[(3-hydroxy-4-methylpentyl)amino]-4-oxobutan-2-yl]cyclohexanecarboxamide (PubChem CID 111460537) has the molecular formula C17H32N2O3 and a molecular weight of 312.45 g/mol. Its IUPAC name is N-[4-[(3-hydroxy-4-methylpentyl)amino]-4-oxobutan-2-yl]cyclohexanecarboxamide.
| Compound Name | N-[4-[(3-hydroxy-4-methylpentyl)amino]-4-oxobutan-2-yl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 111460537 |
| Molecular Formula | C17H32N2O3 |
| Molecular Weight | 312.45 g/mol |
| Exact Mass | 312.24 |
| IUPAC Name | N-[4-[(3-hydroxy-4-methylpentyl)amino]-4-oxobutan-2-yl]cyclohexanecarboxamide |
| SMILES | CC(CC(=O)NCCC(O)C(C)C)NC(=O)C1CCCCC1 |
| InChI | InChI=1S/C17H32N2O3/c1-12(2)15(20)9-10-18-16(21)11-13(3)19-17(22)14-7-5-4-6-8-14/h12-15,20H,4-11H2,1-3H3,(H,18,21)(H,19,22) |
| InChIKey | RPNPAPRSQNTSNN-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.45 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |