C15H26N2O4 — CID 95609074
methyl (3S)-3-[[(3R)-3-(cyclopentanecarbonylamino)butanoyl]amino]butanoate (PubChem CID 95609074) has the molecular formula C15H26N2O4 and a molecular weight of 298.38 g/mol. Its IUPAC name is methyl (3S)-3-[[(3R)-3-(cyclopentanecarbonylamino)butanoyl]amino]butanoate.
| Compound Name | methyl (3S)-3-[[(3R)-3-(cyclopentanecarbonylamino)butanoyl]amino]butanoate |
|---|---|
| PubChem CID | 95609074 |
| Molecular Formula | C15H26N2O4 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | methyl (3S)-3-[[(3R)-3-(cyclopentanecarbonylamino)butanoyl]amino]butanoate |
| SMILES | COC(=O)C[C@H](C)NC(=O)C[C@@H](C)NC(=O)C1CCCC1 |
| InChI | InChI=1S/C15H26N2O4/c1-10(17-15(20)12-6-4-5-7-12)8-13(18)16-11(2)9-14(19)21-3/h10-12H,4-9H2,1-3H3,(H,16,18)(H,17,20)/t10-,11+/m1/s1 |
| InChIKey | AQDCJXORSFXQTO-MNOVXSKESA-N |
| XLogP | 1.14 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |