C14H21NO3 — CID 95168352
but-3-ynyl (3S)-3-(cyclopentanecarbonylamino)butanoate (PubChem CID 95168352) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is but-3-ynyl (3S)-3-(cyclopentanecarbonylamino)butanoate.
| Compound Name | but-3-ynyl (3S)-3-(cyclopentanecarbonylamino)butanoate |
|---|---|
| PubChem CID | 95168352 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | but-3-ynyl (3S)-3-(cyclopentanecarbonylamino)butanoate |
| SMILES | C#CCCOC(=O)C[C@H](C)NC(=O)C1CCCC1 |
| InChI | InChI=1S/C14H21NO3/c1-3-4-9-18-13(16)10-11(2)15-14(17)12-7-5-6-8-12/h1,11-12H,4-10H2,2H3,(H,15,17)/t11-/m0/s1 |
| InChIKey | APRFRUOWRDLBNS-NSHDSACASA-N |
| XLogP | 1.64 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|