C16H17ClN2O3 — CID 111462853
5-(2-chlorophenyl)-N-(4-hydroxycyclohexyl)-1,3-oxazole-4-carboxamide (PubChem CID 111462853) has the molecular formula C16H17ClN2O3 and a molecular weight of 320.78 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-N-(4-hydroxycyclohexyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 5-(2-chlorophenyl)-N-(4-hydroxycyclohexyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 111462853 |
| Molecular Formula | C16H17ClN2O3 |
| Molecular Weight | 320.78 g/mol |
| Exact Mass | 320.09 |
| IUPAC Name | 5-(2-chlorophenyl)-N-(4-hydroxycyclohexyl)-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NC1CCC(O)CC1)c1ncoc1-c1ccccc1Cl |
| InChI | InChI=1S/C16H17ClN2O3/c17-13-4-2-1-3-12(13)15-14(18-9-22-15)16(21)19-10-5-7-11(20)8-6-10/h1-4,9-11,20H,5-8H2,(H,19,21) |
| InChIKey | JBTWMPAOSVNFKH-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.78 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |