C19H22N2O4 — CID 20973922
ethyl 5-[2-(cyclohexylcarbamoyl)phenyl]-1,3-oxazole-4-carboxylate (PubChem CID 20973922) has the molecular formula C19H22N2O4 and a molecular weight of 342.40 g/mol. Its IUPAC name is ethyl 5-[2-(cyclohexylcarbamoyl)phenyl]-1,3-oxazole-4-carboxylate.
| Compound Name | ethyl 5-[2-(cyclohexylcarbamoyl)phenyl]-1,3-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 20973922 |
| Molecular Formula | C19H22N2O4 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | ethyl 5-[2-(cyclohexylcarbamoyl)phenyl]-1,3-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1ncoc1-c1ccccc1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C19H22N2O4/c1-2-24-19(23)16-17(25-12-20-16)14-10-6-7-11-15(14)18(22)21-13-8-4-3-5-9-13/h6-7,10-13H,2-5,8-9H2,1H3,(H,21,22) |
| InChIKey | OXXLMQZJTPALPA-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |