C15H17FN2O2 — CID 111462962
4-(4-fluorophenyl)-N-(3-hydroxybutyl)-1H-pyrrole-3-carboxamide (PubChem CID 111462962) has the molecular formula C15H17FN2O2 and a molecular weight of 276.31 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-(3-hydroxybutyl)-1H-pyrrole-3-carboxamide.
| Compound Name | 4-(4-fluorophenyl)-N-(3-hydroxybutyl)-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 111462962 |
| Molecular Formula | C15H17FN2O2 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 4-(4-fluorophenyl)-N-(3-hydroxybutyl)-1H-pyrrole-3-carboxamide |
| SMILES | CC(O)CCNC(=O)c1c[nH]cc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C15H17FN2O2/c1-10(19)6-7-18-15(20)14-9-17-8-13(14)11-2-4-12(16)5-3-11/h2-5,8-10,17,19H,6-7H2,1H3,(H,18,20) |
| InChIKey | UXWOOWVRPZXBJG-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |