C18H24FN3O — CID 119660333
N-(3-amino-4-methylpentyl)-4-(4-fluorophenyl)-N-methyl-1H-pyrrole-3-carboxamide (PubChem CID 119660333) has the molecular formula C18H24FN3O and a molecular weight of 317.41 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-4-(4-fluorophenyl)-N-methyl-1H-pyrrole-3-carboxamide.
| Compound Name | N-(3-amino-4-methylpentyl)-4-(4-fluorophenyl)-N-methyl-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 119660333 |
| Molecular Formula | C18H24FN3O |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-4-(4-fluorophenyl)-N-methyl-1H-pyrrole-3-carboxamide |
| SMILES | CC(C)C(N)CCN(C)C(=O)c1c[nH]cc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H24FN3O/c1-12(2)17(20)8-9-22(3)18(23)16-11-21-10-15(16)13-4-6-14(19)7-5-13/h4-7,10-12,17,21H,8-9,20H2,1-3H3 |
| InChIKey | WUFFRVJBMVSITF-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |