C18H24ClFN2O — CID 170898691
N-[(3S)-3-amino-4-methylpentyl]-6-fluoro-N-methylnaphthalene-1-carboxamide;hydrochloride (PubChem CID 170898691) has the molecular formula C18H24ClFN2O and a molecular weight of 338.85 g/mol. Its IUPAC name is N-[(3S)-3-amino-4-methylpentyl]-6-fluoro-N-methylnaphthalene-1-carboxamide;hydrochloride.
| Compound Name | N-[(3S)-3-amino-4-methylpentyl]-6-fluoro-N-methylnaphthalene-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 170898691 |
| Molecular Formula | C18H24ClFN2O |
| Molecular Weight | 338.85 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | N-[(3S)-3-amino-4-methylpentyl]-6-fluoro-N-methylnaphthalene-1-carboxamide;hydrochloride |
| SMILES | CC(C)[C@@H](N)CCN(C)C(=O)c1cccc2cc(F)ccc12.Cl |
| InChI | InChI=1S/C18H23FN2O.ClH/c1-12(2)17(20)9-10-21(3)18(22)16-6-4-5-13-11-14(19)7-8-15(13)16;/h4-8,11-12,17H,9-10,20H2,1-3H3;1H/t17-;/m0./s1 |
| InChIKey | UYBKBIVULGLAOM-LMOVPXPDSA-N |
| XLogP | 3.85 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.85 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |