C15H24ClIN2O — CID 119658549
N-(3-amino-4-methylpentyl)-2-iodo-N,3-dimethylbenzamide;hydrochloride (PubChem CID 119658549) has the molecular formula C15H24ClIN2O and a molecular weight of 410.73 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-2-iodo-N,3-dimethylbenzamide;hydrochloride.
| Compound Name | N-(3-amino-4-methylpentyl)-2-iodo-N,3-dimethylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 119658549 |
| Molecular Formula | C15H24ClIN2O |
| Molecular Weight | 410.73 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-2-iodo-N,3-dimethylbenzamide;hydrochloride |
| SMILES | Cc1cccc(C(=O)N(C)CCC(N)C(C)C)c1I.Cl |
| InChI | InChI=1S/C15H23IN2O.ClH/c1-10(2)13(17)8-9-18(4)15(19)12-7-5-6-11(3)14(12)16;/h5-7,10,13H,8-9,17H2,1-4H3;1H |
| InChIKey | DZJQGBVDIGWFGK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.73 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|