C13H18INO2 — CID 103896465
N-(2-ethoxyethyl)-2-iodo-N,3-dimethylbenzamide (PubChem CID 103896465) has the molecular formula C13H18INO2 and a molecular weight of 347.20 g/mol. Its IUPAC name is N-(2-ethoxyethyl)-2-iodo-N,3-dimethylbenzamide.
| Compound Name | N-(2-ethoxyethyl)-2-iodo-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 103896465 |
| Molecular Formula | C13H18INO2 |
| Molecular Weight | 347.20 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | N-(2-ethoxyethyl)-2-iodo-N,3-dimethylbenzamide |
| SMILES | CCOCCN(C)C(=O)c1cccc(C)c1I |
| InChI | InChI=1S/C13H18INO2/c1-4-17-9-8-15(3)13(16)11-7-5-6-10(2)12(11)14/h5-7H,4,8-9H2,1-3H3 |
| InChIKey | HJYHJQWCLDGTGD-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.20 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|