C21H27Cl2N3O — CID 119660116
N-(3-amino-4-methylpentyl)-N-methylbenzo[f]quinoline-5-carboxamide;dihydrochloride (PubChem CID 119660116) has the molecular formula C21H27Cl2N3O and a molecular weight of 408.37 g/mol. Its IUPAC name is N-(3-amino-4-methylpentyl)-N-methylbenzo[f]quinoline-5-carboxamide;dihydrochloride.
| Compound Name | N-(3-amino-4-methylpentyl)-N-methylbenzo[f]quinoline-5-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119660116 |
| Molecular Formula | C21H27Cl2N3O |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | N-(3-amino-4-methylpentyl)-N-methylbenzo[f]quinoline-5-carboxamide;dihydrochloride |
| SMILES | CC(C)C(N)CCN(C)C(=O)c1cc2ccccc2c2cccnc12.Cl.Cl |
| InChI | InChI=1S/C21H25N3O.2ClH/c1-14(2)19(22)10-12-24(3)21(25)18-13-15-7-4-5-8-16(15)17-9-6-11-23-20(17)18;;/h4-9,11,13-14,19H,10,12,22H2,1-3H3;2*1H |
| InChIKey | KMSZDYXQZBXIRJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|