C16H21FN2O3 — CID 111464107
2-(3-fluorophenyl)-N-[2-[(2-hydroxycyclopentyl)methylamino]-2-oxoethyl]acetamide (PubChem CID 111464107) has the molecular formula C16H21FN2O3 and a molecular weight of 308.35 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-N-[2-[(2-hydroxycyclopentyl)methylamino]-2-oxoethyl]acetamide.
| Compound Name | 2-(3-fluorophenyl)-N-[2-[(2-hydroxycyclopentyl)methylamino]-2-oxoethyl]acetamide |
|---|---|
| PubChem CID | 111464107 |
| Molecular Formula | C16H21FN2O3 |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 2-(3-fluorophenyl)-N-[2-[(2-hydroxycyclopentyl)methylamino]-2-oxoethyl]acetamide |
| SMILES | O=C(CNC(=O)Cc1cccc(F)c1)NCC1CCCC1O |
| InChI | InChI=1S/C16H21FN2O3/c17-13-5-1-3-11(7-13)8-15(21)19-10-16(22)18-9-12-4-2-6-14(12)20/h1,3,5,7,12,14,20H,2,4,6,8-10H2,(H,18,22)(H,19,21) |
| InChIKey | GMYBRVITQHQPLI-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |