C18H24N2O4 — CID 111468026
4,4-dimethyl-5-[[5-(2-nitrophenyl)furan-2-yl]methylamino]pentan-2-ol (PubChem CID 111468026) has the molecular formula C18H24N2O4 and a molecular weight of 332.40 g/mol. Its IUPAC name is 4,4-dimethyl-5-[[5-(2-nitrophenyl)furan-2-yl]methylamino]pentan-2-ol.
| Compound Name | 4,4-dimethyl-5-[[5-(2-nitrophenyl)furan-2-yl]methylamino]pentan-2-ol |
|---|---|
| PubChem CID | 111468026 |
| Molecular Formula | C18H24N2O4 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | 4,4-dimethyl-5-[[5-(2-nitrophenyl)furan-2-yl]methylamino]pentan-2-ol |
| SMILES | CC(O)CC(C)(C)CNCc1ccc(-c2ccccc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C18H24N2O4/c1-13(21)10-18(2,3)12-19-11-14-8-9-17(24-14)15-6-4-5-7-16(15)20(22)23/h4-9,13,19,21H,10-12H2,1-3H3 |
| InChIKey | DAINBUFUFMNYTB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|