C17H23NO3S — CID 111468543
1-[(4-methoxy-3-methylsulfanylphenyl)methylamino]-2-(5-methylfuran-2-yl)propan-2-ol (PubChem CID 111468543) has the molecular formula C17H23NO3S and a molecular weight of 321.44 g/mol. Its IUPAC name is 1-[(4-methoxy-3-methylsulfanylphenyl)methylamino]-2-(5-methylfuran-2-yl)propan-2-ol.
| Compound Name | 1-[(4-methoxy-3-methylsulfanylphenyl)methylamino]-2-(5-methylfuran-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 111468543 |
| Molecular Formula | C17H23NO3S |
| Molecular Weight | 321.44 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 1-[(4-methoxy-3-methylsulfanylphenyl)methylamino]-2-(5-methylfuran-2-yl)propan-2-ol |
| SMILES | COc1ccc(CNCC(C)(O)c2ccc(C)o2)cc1SC |
| InChI | InChI=1S/C17H23NO3S/c1-12-5-8-16(21-12)17(2,19)11-18-10-13-6-7-14(20-3)15(9-13)22-4/h5-9,18-19H,10-11H2,1-4H3 |
| InChIKey | JJWZSONBNKERLO-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 54.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.44 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |