C16H18F3NO2 — CID 111468367
2-(5-methylfuran-2-yl)-1-[[3-(trifluoromethyl)phenyl]methylamino]propan-2-ol (PubChem CID 111468367) has the molecular formula C16H18F3NO2 and a molecular weight of 313.32 g/mol. Its IUPAC name is 2-(5-methylfuran-2-yl)-1-[[3-(trifluoromethyl)phenyl]methylamino]propan-2-ol.
| Compound Name | 2-(5-methylfuran-2-yl)-1-[[3-(trifluoromethyl)phenyl]methylamino]propan-2-ol |
|---|---|
| PubChem CID | 111468367 |
| Molecular Formula | C16H18F3NO2 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 2-(5-methylfuran-2-yl)-1-[[3-(trifluoromethyl)phenyl]methylamino]propan-2-ol |
| SMILES | Cc1ccc(C(C)(O)CNCc2cccc(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C16H18F3NO2/c1-11-6-7-14(22-11)15(2,21)10-20-9-12-4-3-5-13(8-12)16(17,18)19/h3-8,20-21H,9-10H2,1-2H3 |
| InChIKey | YZWWMTBYDAGNJO-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 45.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |