C15H19Cl2NO2 — CID 111469648
4-[(6,8-dichloro-2H-chromen-3-yl)methylamino]-3-methylbutan-1-ol (PubChem CID 111469648) has the molecular formula C15H19Cl2NO2 and a molecular weight of 316.23 g/mol. Its IUPAC name is 4-[(6,8-dichloro-2H-chromen-3-yl)methylamino]-3-methylbutan-1-ol.
| Compound Name | 4-[(6,8-dichloro-2H-chromen-3-yl)methylamino]-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 111469648 |
| Molecular Formula | C15H19Cl2NO2 |
| Molecular Weight | 316.23 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | 4-[(6,8-dichloro-2H-chromen-3-yl)methylamino]-3-methylbutan-1-ol |
| SMILES | CC(CCO)CNCC1=Cc2cc(Cl)cc(Cl)c2OC1 |
| InChI | InChI=1S/C15H19Cl2NO2/c1-10(2-3-19)7-18-8-11-4-12-5-13(16)6-14(17)15(12)20-9-11/h4-6,10,18-19H,2-3,7-9H2,1H3 |
| InChIKey | FCDORLGQPUMQMR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.23 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |